Online Database of Chemicals from Around the World
| Name | 2-Benzyl-2-Hydroxy-3-Phenylpropanoic Acid |
|---|---|
| Synonyms | 2-benzyl-2-hydroxy-3-phenylpropanoic acid; 2-benzyl-2-hydroxy-3-phenylpropanoic acid (en) |
| Molecular Structure |  |
| Molecular Formula | C16H16O3 |
| Molecular Weight | 256.30 |
| CAS Registry Number | 20177-12-2 |
| SMILES | O=C(O)C(O)(Cc1ccccc1)Cc2ccccc2 |
| InChI | 1S/C16H16O3/c17-15(18)16(19,11-13-7-3-1-4-8-13)12-14-9-5-2-6-10-14/h1-10,19H,11-12H2,(H,17,18) |
| InChIKey | JHQYMQWWFIWNCS-UHFFFAOYSA-N |
| Density | 1.231g/cm3 (Cal.) |
|---|---|
| Boiling point | 417.225°C at 760 mmHg (Cal.) |
| Flash point | 220.28°C (Cal.) |
| Refractive index | 1.615 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Benzyl-2-Hydroxy-3-Phenylpropanoic Acid |
