Online Database of Chemicals from Around the World
|
CAS#: 20196-71-8 Product: (2S)-3-(Benzyloxy)-2-Phenoxy-1-Propanol No suppilers available for the product. |
| Name | (2S)-3-(Benzyloxy)-2-Phenoxy-1-Propanol |
|---|---|
| Molecular Structure |  |
| Molecular Formula | C16H18O3 |
| Molecular Weight | 258.31 |
| CAS Registry Number | 20196-71-8 |
| SMILES | OC[C@@H](COCc1ccccc1)Oc2ccccc2 |
| InChI | 1S/C16H18O3/c17-11-16(19-15-9-5-2-6-10-15)13-18-12-14-7-3-1-4-8-14/h1-10,16-17H,11-13H2/t16-/m0/s1 |
| InChIKey | BYIQSZTWHNXLCO-INIZCTEOSA-N |
| Density | 1.133g/cm3 (Cal.) |
|---|---|
| Boiling point | 424.074°C at 760 mmHg (Cal.) |
| Flash point | 210.273°C (Cal.) |
| Refractive index | 1.567 (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for (2S)-3-(Benzyloxy)-2-Phenoxy-1-Propanol |