Online Database of Chemicals from Around the World
|
CAS#: 20198-77-0 Product: N-Ethyldichloromaleinimide No suppilers available for the product. |
| Name | N-Ethyldichloromaleinimide |
|---|---|
| Synonyms | 3,4-Dichloro-1-Ethyl-Pyrrole-2,5-Dione; 3,4-Dichloro-1-Ethyl-3-Pyrroline-2,5-Quinone; 1H-Pyrrole-2,5-Dione, 3,4-Dichloro-1-Ethyl- |
| Molecular Structure |  |
| Molecular Formula | C6H5Cl2NO2 |
| Molecular Weight | 194.02 |
| CAS Registry Number | 20198-77-0 |
| SMILES | C(N1C(C(=C(C1=O)Cl)Cl)=O)C |
| InChI | 1S/C6H5Cl2NO2/c1-2-9-5(10)3(7)4(8)6(9)11/h2H2,1H3 |
| InChIKey | UNOAAQSLIJPNKG-UHFFFAOYSA-N |
| Density | 1.534g/cm3 (Cal.) |
|---|---|
| Boiling point | 224.538°C at 760 mmHg (Cal.) |
| Flash point | 89.598°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N-Ethyldichloromaleinimide |