Online Database of Chemicals from Around the World
| Name | 3-05-00-02461 (Beilstein Handbook Reference) |
|---|---|
| Synonyms | 4,5-Methanochrysene; 4,5-Methylenechrysene; 4H-Cyclopenta(Def)Chrysene |
| Molecular Structure |  |
| Molecular Formula | C19H12 |
| Molecular Weight | 240.30 |
| CAS Registry Number | 202-98-2 |
| SMILES | C3=C5C2=C1C(=CC=CC1=CC=C2C4=C3C=CC=C4)C5 |
| InChI | 1S/C19H12/c1-2-7-16-13(4-1)10-15-11-14-6-3-5-12-8-9-17(16)19(15)18(12)14/h1-10H,11H2 |
| InChIKey | GTDQLJVKXFXBMM-UHFFFAOYSA-N |
| Density | 1.296g/cm3 (Cal.) |
|---|---|
| Boiling point | 470.355°C at 760 mmHg (Cal.) |
| Flash point | 229.474°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-05-00-02461 (Beilstein Handbook Reference) |
