|
CAS#: 20264-90-8 Product: 1-Nitro-4-(6-Phenyl-1,3,5-Hexatrien-1-Yl)Benzene No suppilers available for the product. |
| Name | 1-Nitro-4-(6-Phenyl-1,3,5-Hexatrien-1-Yl)Benzene |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C18H15NO2 |
| Molecular Weight | 277.32 |
| CAS Registry Number | 20264-90-8 |
| SMILES | [O-][N+](=O)c2ccc(C=CC=CC=Cc1ccccc1)cc2 |
| InChI | 1S/C18H15NO2/c20-19(21)18-14-12-17(13-15-18)11-5-2-1-4-8-16-9-6-3-7-10-16/h1-15H |
| InChIKey | AYKBAOXEJOHWEE-UHFFFAOYSA-N |
| Density | 1.166g/cm3 (Cal.) |
|---|---|
| Boiling point | 455.377°C at 760 mmHg (Cal.) |
| Flash point | 211.77°C (Cal.) |
| Refractive index | 1.67 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-Nitro-4-(6-Phenyl-1,3,5-Hexatrien-1-Yl)Benzene |