Online Database of Chemicals from Around the World
| Carbosynth China Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 (512) 6260-5585 | |||
 |
sales@carbosynth.com | |||
 |
QQ Chat | |||
| Chemical manufacturer since 2006 Chemical distributor since 2006 | ||||
| chemBlink standard supplier since 2016 | ||||
| Name | N(6)-(delta(2)-Isopentenyl)Adenosine 5'-Monophosphate |
|---|---|
| Synonyms | [3,4-Dihydroxy-5-[6-(3-Methylbut-2-Enylamino)Purin-9-Yl]Tetrahydrofuran-2-Yl]Methyl Dihydrogen Phosphate; [3,4-Dihydroxy-5-[6-(3-Methylbut-2-Enylamino)-9-Purinyl]-2-Tetrahydrofuranyl]Methyl Dihydrogen Phosphate; Nsc268226 |
| Molecular Structure |  |
| Molecular Formula | C15H22N5O7P |
| Molecular Weight | 415.34 |
| CAS Registry Number | 20268-93-3 |
| SMILES | C1=NC3=C([N]1C2OC(CO[P](=O)(O)O)C(C2O)O)N=CN=C3NCC=C(C)C |
| InChI | 1S/C15H22N5O7P/c1-8(2)3-4-16-13-10-14(18-6-17-13)20(7-19-10)15-12(22)11(21)9(27-15)5-26-28(23,24)25/h3,6-7,9,11-12,15,21-22H,4-5H2,1-2H3,(H,16,17,18)(H2,23,24,25) |
| InChIKey | DUISZFLWBAPRBR-UHFFFAOYSA-N |
| Density | 1.759g/cm3 (Cal.) |
|---|---|
| Boiling point | 758.922°C at 760 mmHg (Cal.) |
| Flash point | 412.781°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N(6)-(delta(2)-Isopentenyl)Adenosine 5'-Monophosphate |