| Achemica | Switzerland | Inquire | ||
|---|---|---|---|---|
![]() |
+41 (24) 466-2929 | |||
![]() |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| Alfa Aesar. | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (978) 521-6300 | |||
![]() |
info@alfa.com | |||
| Chemical manufacturer | ||||
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Fluorochem Ltd. | UK | Inquire | ||
|---|---|---|---|---|
![]() |
+44 (1457) 860-111 | |||
![]() |
enquiries@fluorochem.co.uk | |||
| Chemical manufacturer | ||||
| Frinton Laboratories, Inc. | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (856) 722-7037 | |||
![]() |
frinton@frinton.com | |||
| Chemical manufacturer | ||||
| Santa Cruz Biotechnology, Inc. | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (831) 457-3800 | |||
![]() |
scbt@scbt.com | |||
| Chemical manufacturer | ||||
| Name | 2-(1-Methylethyl)-Naphthalene |
|---|---|
| Synonyms | 2-Isopropylnaphthalene; Fr-0361; Naphthalene, Isopropylated |
| Molecular Structure | ![]() |
| Molecular Formula | C13H14 |
| Molecular Weight | 170.25 |
| CAS Registry Number | 2027-17-0 |
| EINECS | 217-976-0 |
| SMILES | C1=C(C(C)C)C=CC2=C1C=CC=C2 |
| InChI | 1S/C13H14/c1-10(2)12-8-7-11-5-3-4-6-13(11)9-12/h3-10H,1-2H3 |
| InChIKey | TVYVQNHYIHAJTD-UHFFFAOYSA-N |
| Density | 0.975 (Expl.) |
|---|---|
| 1.0±0.1g/cm3 (Cal.) | |
| Melting point | 14°C (Expl.) |
| Boiling point | 268.199°C at 760 mmHg (Cal.) |
| 268°C (Expl.) | |
| Flash point | 122°C (Expl.) |
| 109.7±8.9°C (Cal.) | |
| Refractive index | 1.587 (Expl.) |
| Safety Description | CAUTION: May irritate eyes, skin, and respiratory tract |
|---|---|
| SDS | Available |
| Market Analysis Reports |
| List of Reports Available for 2-(1-Methylethyl)-Naphthalene |