|
CAS#: 20278-59-5 Product: 2-Methoxy-4,5-Dinitroaniline No suppilers available for the product. |
| Name | 2-Methoxy-4,5-Dinitroaniline |
|---|---|
| Synonyms | AIDS130603; AIDS-130603; NCI60_004669 |
| Molecular Structure | ![]() |
| Molecular Formula | C7H7N3O5 |
| Molecular Weight | 213.15 |
| CAS Registry Number | 20278-59-5 |
| SMILES | COC1=CC(=C(C=C1N)[N+](=O)[O-])[N+](=O)[O-] |
| InChI | 1S/C7H7N3O5/c1-15-7-3-6(10(13)14)5(9(11)12)2-4(7)8/h2-3H,8H2,1H3 |
| InChIKey | RAGDZFDTRGPPFN-UHFFFAOYSA-N |
| Density | 1.5±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 466.0±40.0°C at 760 mmHg (Cal.) |
| Flash point | 235.7±27.3°C (Cal.) |
| Refractive index | 1.641 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Methoxy-4,5-Dinitroaniline |