Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Name | 3-Isopropylbiphenyl |
|---|---|
| Synonyms | 1-Isopropyl-3-Phenyl-Benzene; 1-Isopropyl-3-Phenylbenzene; 1-Phenyl-3-Propan-2-Yl-Benzene |
| Molecular Structure |  |
| Molecular Formula | C15H16 |
| Molecular Weight | 196.29 |
| CAS Registry Number | 20282-30-8 |
| EINECS | 243-680-6 |
| SMILES | C1=C(C=CC=C1)C2=CC=CC(=C2)C(C)C |
| InChI | 1S/C15H16/c1-12(2)14-9-6-10-15(11-14)13-7-4-3-5-8-13/h3-12H,1-2H3 |
| InChIKey | LIWRTHVZRZXVFX-UHFFFAOYSA-N |
| Density | 0.958g/cm3 (Cal.) |
|---|---|
| Boiling point | 300.47°C at 760 mmHg (Cal.) |
| Flash point | 138.407°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-Isopropylbiphenyl |