Online Database of Chemicals from Around the World
|
CAS#: 20291-98-9 Product: 4-(Methylamino)-2,6-Dinitrophenol No suppilers available for the product. |
| Name | 4-(Methylamino)-2,6-Dinitrophenol |
|---|---|
| Synonyms | 4-Methylamino-2,6-Dinitro-Phenol; 4-(Methylamino)-2,6-Dinitrophenol |
| Molecular Structure |  |
| Molecular Formula | C7H7N3O5 |
| Molecular Weight | 213.15 |
| CAS Registry Number | 20291-98-9 |
| EINECS | 243-695-8 |
| SMILES | C1=C(NC)C=C([N+]([O-])=O)C(=C1[N+]([O-])=O)O |
| InChI | 1S/C7H7N3O5/c1-8-4-2-5(9(12)13)7(11)6(3-4)10(14)15/h2-3,8,11H,1H3 |
| InChIKey | RHHQGGGEFAQZLY-UHFFFAOYSA-N |
| Density | 1.627g/cm3 (Cal.) |
|---|---|
| Boiling point | 302.426°C at 760 mmHg (Cal.) |
| Flash point | 136.703°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-(Methylamino)-2,6-Dinitrophenol |