Online Database of Chemicals from Around the World
| Ryan Scientific, Inc. | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (843)-884-4911 | |||
 |
sales@ryansci.com | |||
| Chemical manufacturer | ||||
| Name | 4,5-Epiminophenanthrene |
|---|---|
| Synonyms | 4,5-Iminophenanthrene; 4H-Benzo(Def)Carbazole |
| Molecular Structure |  |
| Molecular Formula | C14H9N |
| Molecular Weight | 191.23 |
| CAS Registry Number | 203-65-6 |
| EINECS | 205-906-1 |
| SMILES | C1=CC4=C3C2=C1C=CC=C2[NH]C3=CC=C4 |
| InChI | 1S/C14H9N/c1-3-9-7-8-10-4-2-6-12-14(10)13(9)11(5-1)15-12/h1-8,15H |
| InChIKey | VQOUCGZKKPJLGH-UHFFFAOYSA-N |
| Density | 1.363g/cm3 (Cal.) |
|---|---|
| Boiling point | 391.232°C at 760 mmHg (Cal.) |
| Flash point | 177.547°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4,5-Epiminophenanthrene |