Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | 3-(Ethylamino)Phthalic Acid |
|---|---|
| Synonyms | 3-(ethylamino)phthalic acid |
| Molecular Structure |  |
| Molecular Formula | C10H11NO4 |
| Molecular Weight | 209.20 |
| CAS Registry Number | 203194-63-2 |
| SMILES | CCNc1cccc(c1C(=O)O)C(=O)O |
| InChI | 1S/C10H11NO4/c1-2-11-7-5-3-4-6(9(12)13)8(7)10(14)15/h3-5,11H,2H2,1H3,(H,12,13)(H,14,15) |
| InChIKey | GHVJJEYPCFLKQD-UHFFFAOYSA-N |
| Density | 1.39g/cm3 (Cal.) |
|---|---|
| Boiling point | 430.833°C at 760 mmHg (Cal.) |
| Flash point | 214.361°C (Cal.) |
| Refractive index | 1.642 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-(Ethylamino)Phthalic Acid |