Online Database of Chemicals from Around the World
|
CAS#: 20404-02-8 Product: 2,3,6-Trichloro-4-Nitrophenol No suppilers available for the product. |
| Name | 2,3,6-Trichloro-4-Nitrophenol |
|---|---|
| Synonyms | 2,3,6-Trichloro-4-Nitro-Phenol; Nsc141443 |
| Molecular Structure |  |
| Molecular Formula | C6H2Cl3NO3 |
| Molecular Weight | 242.45 |
| CAS Registry Number | 20404-02-8 |
| SMILES | C1=C(C(=C(C(=C1[N+]([O-])=O)Cl)Cl)O)Cl |
| InChI | 1S/C6H2Cl3NO3/c7-2-1-3(10(12)13)4(8)5(9)6(2)11/h1,11H |
| InChIKey | UAXQXSVCGHEVMI-UHFFFAOYSA-N |
| Density | 1.788g/cm3 (Cal.) |
|---|---|
| Boiling point | 313.517°C at 760 mmHg (Cal.) |
| Flash point | 143.41°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,3,6-Trichloro-4-Nitrophenol |