Online Database of Chemicals from Around the World
| Amadis Chemical Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 (571) 8992-5085 | |||
 |
sales@amadischem.com | |||
 |
Skype Chat | |||
| Chemical manufacturer since 2011 | ||||
| chemBlink standard supplier since 2016 | ||||
| Name | 6 alpha-Naloxol |
|---|---|
| Synonyms | 6Alpha-Naloxol; (5Alpha,6Alpha)-4,5-Epoxy-17-(2-Propenyl)Morphinan-3,6,14-Triol |
| Molecular Structure |  |
| Molecular Formula | C19H23NO4 |
| Molecular Weight | 329.40 |
| CAS Registry Number | 20410-95-1 |
| SMILES | [C@]124[C@]5(O)[C@H](N(CC1)CC=C)CC3=CC=C(O)C(=C23)O[C@H]4[C@@H](O)CC5 |
| InChI | 1S/C19H23NO4/c1-2-8-20-9-7-18-15-11-3-4-12(21)16(15)24-17(18)13(22)5-6-19(18,23)14(20)10-11/h2-4,13-14,17,21-23H,1,5-10H2/t13-,14+,17-,18-,19+/m0/s1 |
| InChIKey | HMWHERQFMBEHNG-AQQQZIQISA-N |
| Density | 1.437g/cm3 (Cal.) |
|---|---|
| Boiling point | 532.455°C at 760 mmHg (Cal.) |
| Flash point | 275.819°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 6 alpha-Naloxol |