Online Database of Chemicals from Around the World
|
CAS#: 20416-08-4 Product: Methyl 5-Benzyl-3-Furoate No suppilers available for the product. |
| Name | Methyl 5-Benzyl-3-Furoate |
|---|---|
| Synonyms | 5-(Phenylmethyl)-3-Furancarboxylic Acid Methyl Ester; 5-(Benzyl)Furan-3-Carboxylic Acid Methyl Ester; 3-Furancarboxylic Acid, 5-(Phenylmethyl)-, Methyl Ester |
| Molecular Structure |  |
| Molecular Formula | C13H12O3 |
| Molecular Weight | 216.24 |
| CAS Registry Number | 20416-08-4 |
| EINECS | 243-801-2 |
| SMILES | C1=CC=C(C=C1)CC2=CC(=CO2)C(=O)OC |
| InChI | 1S/C13H12O3/c1-15-13(14)11-8-12(16-9-11)7-10-5-3-2-4-6-10/h2-6,8-9H,7H2,1H3 |
| InChIKey | DGEHQARARXBTFY-UHFFFAOYSA-N |
| Density | 1.141g/cm3 (Cal.) |
|---|---|
| Boiling point | 320.577°C at 760 mmHg (Cal.) |
| Flash point | 147.68°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Methyl 5-Benzyl-3-Furoate |