Online Database of Chemicals from Around the World
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (631) 485-4226 | |||
 |
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Name | 4-(2-Chloroethylamino)Benzoic Acid |
|---|---|
| Synonyms | P-((2-Chloroethyl)Amino)Benzoic Acid; Benzoic Acid, P-(2-Chloroethyl)Amino-; Brn 2803827 |
| Molecular Structure |  |
| Molecular Formula | C9H10ClNO2 |
| Molecular Weight | 199.64 |
| CAS Registry Number | 2045-23-0 |
| SMILES | C1=C(C=CC(=C1)NCCCl)C(O)=O |
| InChI | 1S/C9H10ClNO2/c10-5-6-11-8-3-1-7(2-4-8)9(12)13/h1-4,11H,5-6H2,(H,12,13) |
| InChIKey | UWDKMSKDFPXPAM-UHFFFAOYSA-N |
| Density | 1.337g/cm3 (Cal.) |
|---|---|
| Boiling point | 389.755°C at 760 mmHg (Cal.) |
| Flash point | 189.517°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-(2-Chloroethylamino)Benzoic Acid |