Online Database of Chemicals from Around the World
|
CAS#: 2047-14-5 Product: 2-Diethoxyphosphinothioylsulfanylacetamide No suppilers available for the product. |
| Name | 2-Diethoxyphosphinothioylsulfanylacetamide |
|---|---|
| Synonyms | 2-(Diethoxyphosphinothioylthio)Acetamide; 2-(Diethoxythiophosphorylthio)Acetamide; 2-Diethoxyphosphinothioylsulfanylethanamide |
| Molecular Structure |  |
| Molecular Formula | C6H14NO3PS2 |
| Molecular Weight | 243.28 |
| CAS Registry Number | 2047-14-5 |
| SMILES | C(O[P](OCC)(SCC(=O)N)=S)C |
| InChI | 1S/C6H14NO3PS2/c1-3-9-11(12,10-4-2)13-5-6(7)8/h3-5H2,1-2H3,(H2,7,8) |
| InChIKey | YHZHCEYCTFAWOU-UHFFFAOYSA-N |
| Density | 1.3g/cm3 (Cal.) |
|---|---|
| Boiling point | 351.496°C at 760 mmHg (Cal.) |
| Flash point | 166.379°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Diethoxyphosphinothioylsulfanylacetamide |