Online Database of Chemicals from Around the World
|
CAS#: 20492-50-6 Product: Trioxobis(Pyridine)Chromium No suppilers available for the product. |
| Name | Trioxobis(Pyridine)Chromium |
|---|---|
| Synonyms | Pyridine; Triketochromium; Chromium, Trioxobis(Pyridine)- |
| Molecular Structure |  |
| Molecular Formula | C10H10CrN2O3 |
| Molecular Weight | 258.20 |
| CAS Registry Number | 20492-50-6 (26412-88-4) |
| EINECS | 243-853-6 |
| SMILES | O=[Cr](=O)=O.C1=NC=CC=C1.C2=NC=CC=C2 |
| InChI | 1S/2C5H5N.Cr.3O/c2*1-2-4-6-5-3-1;;;;/h2*1-5H;;;; |
| InChIKey | NPRDHMWYZHSAHR-UHFFFAOYSA-N |
| Boiling point | 115.3°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 20°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Trioxobis(Pyridine)Chromium |