Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | 1-(3-Hydroxypropyl)-L-Prolinamide |
|---|---|
| Synonyms | (S)-1-(3-hydroxypropyl)pyrrolidine-2-carboxamide |
| Molecular Structure |  |
| Molecular Formula | C8H16N2O2 |
| Molecular Weight | 172.22 |
| CAS Registry Number | 205194-24-7 |
| SMILES | C1C[C@H](N(C1)CCCO)C(=O)N |
| InChI | 1S/C8H16N2O2/c9-8(12)7-3-1-4-10(7)5-2-6-11/h7,11H,1-6H2,(H2,9,12)/t7-/m0/s1 |
| InChIKey | YQOIMZKACQSQFU-ZETCQYMHSA-N |
| Density | 1.15g/cm3 (Cal.) |
|---|---|
| Boiling point | 393.17°C at 760 mmHg (Cal.) |
| Flash point | 191.582°C (Cal.) |
| Refractive index | 1.521 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-(3-Hydroxypropyl)-L-Prolinamide |