| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
![]() | www.bocsci.com | |||
![]() | +1 (631) 485-4226 | |||
![]() | +1 (631) 614-7828 | |||
![]() | info@bocsci.com | |||
| Chemical manufacturer | ||||
| chemBlink Standard supplier since 2010 | ||||
| Classification | Biochemical >> Nucleoside drugs >> Nucleoside intermediate |
|---|---|
| Name | 2-(6-Aminopurin-9-yl)-5-methylideneoxolane-3,4-diol |
| Molecular Structure | ![]() |
| Molecular Formula | C10H11N5O3 |
| Molecular Weight | 249.23 |
| CAS Registry Number | 20535-04-0 |
| SMILES | C=C1C(C(C(O1)N2C=NC3=C(N=CN=C32)N)O)O |
| Solubility | 8136 mg/L (25 °C water) |
|---|---|
| Density | 1.9±0.1 g/cm3, Calc.* |
| Index of Refraction | 1.867, Calc.* |
| Melting point | 209.96 °C |
| Boiling Point | 591.1±60.0 °C (760 mmHg), Calc.*, 494.35 °C |
| Flash Point | 311.3±32.9 °C, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Market Analysis Reports |
| List of Reports Available for 2-(6-Aminopurin-9-yl)-5-methylideneoxolane-3,4-diol |