Online Database of Chemicals from Around the World
|
CAS#: 2054-82-2 Product: 21,22-Dihydrostrychnidine No suppilers available for the product. |
| Name | 21,22-Dihydrostrychnidine |
|---|---|
| Synonyms | 21,22-Dihydrostrychnidine; 4-27-00-07207 (Beilstein Handbook Reference); Brn 0094363 |
| Molecular Structure |  |
| Molecular Formula | C21H26N2O |
| Molecular Weight | 322.45 |
| CAS Registry Number | 2054-82-2 |
| SMILES | [C@@H]23N5C1=CC=CC=C1C27[C@H]6N(C[C@@H]4[C@@H]([C@H]3[C@@H](OCC4)CC5)C6)CC7 |
| InChI | 1S/C21H26N2O/c1-2-4-16-15(3-1)21-7-9-22-12-13-6-10-24-17-5-8-23(16)20(21)19(17)14(13)11-18(21)22/h1-4,13-14,17-20H,5-12H2/t13-,14+,17+,18+,19+,20+,21?/m1/s1 |
| InChIKey | KZTJNVKGHFKUCI-JUCGOJCYSA-N |
| Density | 1.314g/cm3 (Cal.) |
|---|---|
| Boiling point | 482.529°C at 760 mmHg (Cal.) |
| Flash point | 143.854°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 21,22-Dihydrostrychnidine |