Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Name | [(4R)-4,8-Dimethylnonyl]Benzene |
|---|---|
| Molecular Structure | ![CAS#: 205529-85-7， [(4R)-4,8-Dimethylnonyl]Benzene](/moreStructures/205529-85-7.gif) |
| Molecular Formula | C17H28 |
| Molecular Weight | 232.40 |
| CAS Registry Number | 205529-85-7 |
| SMILES | c1ccccc1CCC[C@H](C)CCCC(C)C |
| InChI | 1S/C17H28/c1-15(2)9-7-10-16(3)11-8-14-17-12-5-4-6-13-17/h4-6,12-13,15-16H,7-11,14H2,1-3H3/t16-/m1/s1 |
| InChIKey | STMINNULIMUIHI-MRXNPFEDSA-N |
| Density | 0.856g/cm3 (Cal.) |
|---|---|
| Boiling point | 306.045°C at 760 mmHg (Cal.) |
| Flash point | 134.067°C (Cal.) |
| Refractive index | 1.482 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for [(4R)-4,8-Dimethylnonyl]Benzene |