(3S,4S)-3-Methyl-2-oxa-8-azaspiro[4.5]decan-4-amine dihydrochloride
[CAS# 2055761-19-6]

Identification

• Classification: Chemical reagent >> Organic reagent >> Amine salt (ammonium salt)
• Name: (3S,4S)-3-Methyl-2-oxa-8-azaspiro[4.5]decan-4-amine dihydrochloride
• Molecular Formula: C₉H₂₀Cl₂N₂O
• Molecular Weight: 243.17
• CAS Registry Number: 2055761-19-6
• SMILES: C[C@H]1[C@H](C2(CCNCC2)CO1)N.Cl.Cl

Safety Data

• Hazard Symbols: GHS07 Warning
• Risk Statements: H302-H315-H319-H335
• Safety Statements: P261-P305+P351+P338

Discovery and Applications

(3S,4S)-3-Methyl-2-oxa-8-azaspiro[4.5]decan-4-amine dihydrochloride is a chemical compound that belongs to the class of spirocyclic amines, characterized by its complex molecular structure. It contains a spirocyclic system, which is a structural motif where two rings share one atom, in this case, an azaspiro system. This particular compound also contains a methyl group (-CH₃), an amine group (-NH₂), and an oxygen atom, giving it a diverse functional group profile. Additionally, it is presented as a dihydrochloride salt, which indicates that the compound is in a salt form with two hydrochloric acid molecules associated with it.

The compound's structure is defined by a spiro[4.5]decane core, with nitrogen (in the 8-aza position) and oxygen (in the 2-oxa position) atoms incorporated into the ring system. The configuration of the chiral centers at the 3 and 4 positions (denoted as (3S,4S)) indicates the specific stereochemistry of the compound, which plays a crucial role in determining its biological activity and interactions.

The discovery of such spirocyclic amines, especially those incorporating nitrogen and oxygen atoms, has been an area of interest in medicinal chemistry. The spirocyclic framework is known for its rigidity and unique three-dimensional shape, which can lead to compounds with specific biological activities. These properties make spirocyclic amines valuable for the development of new drugs, particularly those targeting receptors or enzymes in the central nervous system or other tissues.

In terms of applications, compounds like (3S,4S)-3-methyl-2-oxa-8-azaspiro[4.5]decan-4-amine dihydrochloride have potential uses in the pharmaceutical industry. The inclusion of both nitrogen and oxygen in the spirocyclic structure may influence the compound's pharmacokinetic properties, such as solubility, permeability, and stability. Furthermore, the specific stereochemistry and functional groups could allow for selective binding to biological targets, such as receptors, enzymes, or transport proteins.

Such compounds may also show promise in the development of agents for the treatment of neurological disorders, given the presence of nitrogen, which is common in compounds with central nervous system activity. Moreover, spirocyclic compounds are often explored for their potential as novel scaffolds in drug discovery, as the rigidity of the structure can lead to high specificity in binding to target biomolecules.

The dihydrochloride salt form of (3S,4S)-3-methyl-2-oxa-8-azaspiro[4.5]decan-4-amine is important for its solubility and stability, as salts are often more easily dissolved in water, which is essential for their formulation into pharmaceutical dosage forms. The dihydrochloride salt form can also influence the compound's pharmacodynamics, improving its bioavailability and facilitating its absorption when administered.

In summary, (3S,4S)-3-methyl-2-oxa-8-azaspiro[4.5]decan-4-amine dihydrochloride is a spirocyclic compound with significant potential for pharmaceutical and medicinal chemistry applications. Its unique structure, characterized by a spiro[4.5]decane core, nitrogen and oxygen heteroatoms, and amine functionality, provides a basis for developing drugs with high specificity and activity against biological targets. While its direct therapeutic applications may require further exploration, compounds of this type represent promising candidates for the development of novel therapeutics.