Online Database of Chemicals from Around the World
| Name | 7-Azafluoranthene |
|---|---|
| Synonyms | Acenaphtho(1,2-B)Pyridine |
| Molecular Structure |  |
| Molecular Formula | C15H9N |
| Molecular Weight | 203.24 |
| CAS Registry Number | 206-49-5 |
| EINECS | 205-914-5 |
| SMILES | C1=CC=C3C2=C1C4=C(C2=CC=C3)N=CC=C4 |
| InChI | 1S/C15H9N/c1-4-10-5-2-7-13-14(10)11(6-1)12-8-3-9-16-15(12)13/h1-9H |
| InChIKey | XJWJTIKXJYAHBE-UHFFFAOYSA-N |
| Density | 1.31g/cm3 (Cal.) |
|---|---|
| Boiling point | 385.51°C at 760 mmHg (Cal.) |
| Flash point | 172.96°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 7-Azafluoranthene |
