Online Database of Chemicals from Around the World
|
CAS#: 206-55-3 Product: Indeno(1,2,3-De)Quinoline No suppilers available for the product. |
| Name | Indeno(1,2,3-De)Quinoline |
|---|---|
| Molecular Structure |  |
| Molecular Formula | C15H9N |
| Molecular Weight | 203.24 |
| CAS Registry Number | 206-55-3 |
| SMILES | C3=C1C4=C(C2=CC=NC(=C12)C=C3)C=CC=C4 |
| InChI | 1S/C15H9N/c1-2-5-11-10(4-1)12-6-3-7-14-15(12)13(11)8-9-16-14/h1-9H |
| InChIKey | LBRODQCXTUTGSV-UHFFFAOYSA-N |
| Density | 1.31g/cm3 (Cal.) |
|---|---|
| Boiling point | 385.51°C at 760 mmHg (Cal.) |
| Flash point | 172.96°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Indeno(1,2,3-De)Quinoline |