Online Database of Chemicals from Around the World
| Name | 6,7-Dimethylbenz[a]Anthracene |
|---|---|
| Synonyms | 4,10-Dimethyl-1,2-Benzanthracene; 6,7-Dimethylbenz(A)Anthracene; Brn 1963004 |
| Molecular Structure | ![CAS#: 20627-28-5， 6,7-Dimethylbenz[a]Anthracene](/moreStructures/20627-28-5.gif) |
| Molecular Formula | C20H16 |
| Molecular Weight | 256.35 |
| CAS Registry Number | 20627-28-5 |
| SMILES | C4=C1C=CC=CC1=C3C=C2C=CC=CC2=C(C)C3=C4C |
| InChI | 1S/C20H16/c1-13-11-15-7-4-6-10-18(15)19-12-16-8-3-5-9-17(16)14(2)20(13)19/h3-12H,1-2H3 |
| InChIKey | WPDOEEIWRBGJOK-UHFFFAOYSA-N |
| Density | 1.143g/cm3 (Cal.) |
|---|---|
| Boiling point | 468.017°C at 760 mmHg (Cal.) |
| Flash point | 230.036°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 6,7-Dimethylbenz[a]Anthracene |
