|
CAS#: 20671-78-7 Product: N,N-Diethyltryptamine oxalate No suppilers available for the product. |
| Name | N,N-Diethyltryptamine oxalate |
|---|---|
| Synonyms | Diethyl-[2-(1H-Indol-3-Yl)Ethyl]Amine; Oxalic Acid; N,N-Diethyl-2-(1H-Indol-3-Yl)Ethanamine; Ethanedioic Acid; 3-(2-(Diethylamino)Ethyl)Indole Oxalate (1:1) |
| Molecular Structure | ![]() |
| Molecular Formula | C16H22N2O4 |
| Molecular Weight | 306.36 |
| CAS Registry Number | 20671-78-7 |
| SMILES | O=C(O)C(=O)O.C1=C(C2=C([NH]1)C=CC=C2)CCN(CC)CC |
| InChI | 1S/C14H20N2.C2H2O4/c1-3-16(4-2)10-9-12-11-15-14-8-6-5-7-13(12)14;3-1(4)2(5)6/h5-8,11,15H,3-4,9-10H2,1-2H3;(H,3,4)(H,5,6) |
| InChIKey | BEAQJJFFASUCHK-UHFFFAOYSA-N |
| Boiling point | 359.8°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 171.4°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N,N-Diethyltryptamine oxalate |