Online Database of Chemicals from Around the World
| Name | Diethoxyphosphoryloxy-Ethoxy-Phosphinic Acid |
|---|---|
| Synonyms | (Ethoxy-Hydroxy-Phosphoryl) Diethyl Phosphate; Phosphoric Acid (Ethoxy-Hydroxyphosphoryl) Diethyl Ester; Phosphoric Acid (Ethoxy-Hydroxy-Phosphoryl) Diethyl Ester |
| Molecular Structure |  |
| Molecular Formula | C6H16O7P2 |
| Molecular Weight | 262.14 |
| CAS Registry Number | 20680-55-1 |
| SMILES | C(O[P](=O)(O)O[P](=O)(OCC)OCC)C |
| InChI | 1S/C6H16O7P2/c1-4-10-14(7,8)13-15(9,11-5-2)12-6-3/h4-6H2,1-3H3,(H,7,8) |
| InChIKey | NDLNATOTGAPSLR-UHFFFAOYSA-N |
| Density | 1.318g/cm3 (Cal.) |
|---|---|
| Boiling point | 308.312°C at 760 mmHg (Cal.) |
| Flash point | 140.262°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Diethoxyphosphoryloxy-Ethoxy-Phosphinic Acid |
