Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | 3-Aminotricyclo[2.2.1.02,6]Heptane-3,5-Dicarboxylic Acid |
|---|---|
| Synonyms | 3-aminotricyclo[2.2.1.02,6]heptane-3,5-dicarboxylic acid |
| Molecular Structure | ![CAS#: 206996-11-4， 3-Aminotricyclo[2.2.1.0<Sup>2,6</Sup>]Heptane-3,5-Dicarboxylic Acid](/moreStructures/206996-11-4.gif) |
| Molecular Formula | C9H11NO4 |
| Molecular Weight | 197.19 |
| CAS Registry Number | 206996-11-4 |
| SMILES | NC3(C1CC2C(C1C(O)=O)C23)C(O)=O |
| InChI | 1S/C9H11NO4/c10-9(8(13)14)3-1-2-4(6(2)9)5(3)7(11)12/h2-6H,1,10H2,(H,11,12)(H,13,14) |
| InChIKey | GJLINDSEAGONOA-UHFFFAOYSA-N |
| Density | 1.689g/cm3 (Cal.) |
|---|---|
| Boiling point | 400.02°C at 760 mmHg (Cal.) |
| Flash point | 195.725°C (Cal.) |
| Refractive index | 1.679 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-Aminotricyclo[2.2.1.02,6]Heptane-3,5-Dicarboxylic Acid |