Online Database of Chemicals from Around the World
| MP Biomedicals LLC. | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (440) 337-1200 | |||
 |
info@mpbio.com | |||
| Chemical manufacturer | ||||
| Sigma-Aldrich, Inc. | USA | Inquire | ||
|---|---|---|---|---|
|
+86 (21) 6141-5566 / 800-819-3336 | |||
|
ordercn@sial.com, | |||
| Chemical manufacturer since 1992 | ||||
| Name | (Z)-N-Hydroxy-1-(4-Nitrophenyl)Methanimine |
|---|---|
| Synonyms | 4-nitrobenzaldehyde oxime; 4-Nitrobenzaldehyde oxime, cis; 4-nitrobenzaldoxime |
| Molecular Structure |  |
| Molecular Formula | C7H6N2O3 |
| Molecular Weight | 166.13 |
| CAS Registry Number | 20707-69-1 |
| SMILES | O=[N+]([O-])c1ccc(/C=N\O)cc1 |
| InChI | 1S/C7H6N2O3/c10-8-5-6-1-3-7(4-2-6)9(11)12/h1-5,10H/b8-5- |
| InChIKey | WTLPAVBACRIHHC-YVMONPNESA-N |
| Density | 1.339g/cm3 (Cal.) |
|---|---|
| Melting point | 126°C (Expl.) |
| Boiling point | 304.201°C at 760 mmHg (Cal.) |
| Flash point | 137.776°C (Cal.) |
| Refractive index | 1.589 (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for (Z)-N-Hydroxy-1-(4-Nitrophenyl)Methanimine |