Online Database of Chemicals from Around the World
|
CAS#: 2078-16-2 Product: Trimethylsilyl 3,4-Dimethoxybenzoate No suppilers available for the product. |
| Name | Trimethylsilyl 3,4-Dimethoxybenzoate |
|---|---|
| Synonyms | 3,4-DIMETHOXYBENZOIC ACID TRIMETHYLSILYL ESTER; Trimethylsilyl 3,4-dimethoxybenzoate # |
| Molecular Structure |  |
| Molecular Formula | C12H18O4Si |
| Molecular Weight | 254.35 |
| CAS Registry Number | 2078-16-2 |
| SMILES | O=C(O[Si](C)(C)C)c1cc(OC)c(OC)cc1 |
| InChI | 1S/C12H18O4Si/c1-14-10-7-6-9(8-11(10)15-2)12(13)16-17(3,4)5/h6-8H,1-5H3 |
| InChIKey | JZIXRRXJQVBHJP-UHFFFAOYSA-N |
| Density | 1.042g/cm3 (Cal.) |
|---|---|
| Boiling point | 291.941°C at 760 mmHg (Cal.) |
| Flash point | 108.386°C (Cal.) |
| Refractive index | 1.48 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Trimethylsilyl 3,4-Dimethoxybenzoate |