Online Database of Chemicals from Around the World
| Achemica | Switzerland | Inquire | ||
|---|---|---|---|---|
 |
+41 (24) 466-2929 | |||
 |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| Tyger Scientific Inc. | USA | Inquire | ||
|---|---|---|---|---|
|
+1 (609) 434-0144 | |||
|
sales@tygersci.com | |||
| Chemical manufacturer since 1992 | ||||
| Name | Methyl 3-(Phenylethynyl)Benzoate |
|---|---|
| Synonyms | BENZOIC ACID, 3-(PHENYLETHYNYL)-, METHYL ESTER; Methyl 3-phenylethynyl-benzoate |
| Molecular Structure |  |
| Molecular Formula | C16H12O2 |
| Molecular Weight | 236.27 |
| CAS Registry Number | 207845-32-7 |
| SMILES | O=C(OC)c2cc(C#Cc1ccccc1)ccc2 |
| InChI | 1S/C16H12O2/c1-18-16(17)15-9-5-8-14(12-15)11-10-13-6-3-2-4-7-13/h2-9,12H,1H3 |
| InChIKey | DIOFUMRRFPINEJ-UHFFFAOYSA-N |
| Density | 1.169g/cm3 (Cal.) |
|---|---|
| Boiling point | 384.305°C at 760 mmHg (Cal.) |
| Flash point | 161.506°C (Cal.) |
| Refractive index | 1.608 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Methyl 3-(Phenylethynyl)Benzoate |