| Pure Research Chemicals | China | Inquire | ||
|---|---|---|---|---|
![]() | www.purerechem.com | |||
![]() | +86 (551) 6288-8437 +86 18096409024 | |||
![]() | info@purerechem.com | |||
![]() | QQ Chat | |||
![]() | Skype Chat | |||
![]() | WeChat: 18856022585 | |||
| Chemical manufacturer since 2018 | ||||
| Name | Oseltamivir Impurity 10 |
|---|---|
| Synonyms | (3S,4R,5S)-Oseltamivir;Ethyl (3S,4R,5S)-4-acetamido-5-amino-3-(3-pentanyloxy)-1-cyclohexene-1-carboxylate |
| Molecular Structure | ![]() |
| Molecular Formula | C16H28N2O4 |
| Molecular Weight | 312.40 |
| CAS Registry Number | 2081110-43-0 |
| SMILES | CCC(CC)O[C@@H](C=C(C(OCC)=O)C[C@@H]1N)[C@@H]1NC(C)=O |
| Density | 1.1±0.1 g/cm3, Calc.* |
|---|---|
| Index of Refraction | 1.502, Calc.* |
| Boiling Point | 473.3±45.0 °C (760 mmHg), Calc.* |
| Flash Point | 240.0±28.7 °C, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Market Analysis Reports |
| List of Reports Available for Oseltamivir Impurity 10 |