| Achemica | Switzerland | Inquire | ||
|---|---|---|---|---|
![]() |
+41 (24) 466-2929 | |||
![]() |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (201) 478-8534 | |||
![]() |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Fluorochem Ltd. | UK | Inquire | ||
|---|---|---|---|---|
![]() |
+44 (1457) 860-111 | |||
![]() |
enquiries@fluorochem.co.uk | |||
| Chemical manufacturer | ||||
| Manchester Organics Ltd. | UK | Inquire | ||
|---|---|---|---|---|
![]() |
+44 (1928) 710-200 | |||
![]() |
info@manchesterorganics.com | |||
| Chemical manufacturer | ||||
| P and M Invest Ltd. | Russian Federation | Inquire | ||
|---|---|---|---|---|
![]() |
+7 (495) 135-6494 | |||
![]() |
sales@fluorine.ru | |||
| Chemical manufacturer | ||||
| SynQuest Labs, Inc. | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (386) 462-0788 | |||
![]() |
info@synquestlabs.com | |||
| Chemical manufacturer | ||||
| Zylexa Pharma Ltd. | UK | Inquire | ||
|---|---|---|---|---|
![]() |
+44 (845) 299-6009/ | |||
![]() |
sales@zylexa-pharma.com,enquiries@zylexa-pharma.com | |||
| Chemical manufacturer | ||||
| Name | 1,2,4,5-Tetrafluoro-3-Methoxy-6-(Trifluoromethyl)Benzene |
|---|---|
| Synonyms | 2,3,5,6-Tetrafluoro-4-(trifluoromethyl)anisole; 2,3,5,6-tetrafluoro-4-methoxy-1-(trifluoromethyl)benzene; 4-Methoxy-2,3,5,6-tetrafluorobenzotrifluoride |
| Molecular Structure | ![]() |
| Molecular Formula | C8H3F7O |
| Molecular Weight | 248.10 |
| CAS Registry Number | 20867-94-1 |
| SMILES | Fc1c(F)c(c(F)c(F)c1OC)C(F)(F)F |
| InChI | 1S/C8H3F7O/c1-16-7-5(11)3(9)2(8(13,14)15)4(10)6(7)12/h1H3 |
| InChIKey | IZAURIRLQJRFML-UHFFFAOYSA-N |
| Density | 1.515g/cm3 (Cal.) |
|---|---|
| Boiling point | 157.333°C at 760 mmHg (Cal.) |
| 168-169°C (Expl.) | |
| Flash point | 54.999°C (Cal.) |
| Refractive index | 1.379 (Cal.) |
| 1.437 (Expl.) | |
| Safety Description | S24/25,S36/37/39,S45 |
|---|---|
| R36/37/38 | |
| Irritant | |
| Market Analysis Reports |
| List of Reports Available for 1,2,4,5-Tetrafluoro-3-Methoxy-6-(Trifluoromethyl)Benzene |