Online Database of Chemicals from Around the World
|
CAS#: 2088-72-4 Product: Ethyl 2-Dimethoxyphosphorylsulfanylacetate No suppilers available for the product. |
| Name | Ethyl 2-Dimethoxyphosphorylsulfanylacetate |
|---|---|
| Synonyms | 2-(Dimethoxyphosphorylthio)Acetic Acid Ethyl Ester; Ethyl 2-Dimethoxyphosphorylsulfanylethanoate; Ai3-27527 |
| Molecular Structure |  |
| Molecular Formula | C6H13O5PS |
| Molecular Weight | 228.20 |
| CAS Registry Number | 2088-72-4 |
| SMILES | C(C)OC(=O)CS[P](=O)(OC)OC |
| InChI | 1S/C6H13O5PS/c1-4-11-6(7)5-13-12(8,9-2)10-3/h4-5H2,1-3H3 |
| InChIKey | LIXQYRZDAFGLSQ-UHFFFAOYSA-N |
| Density | 1.255g/cm3 (Cal.) |
|---|---|
| Boiling point | 265.126°C at 760 mmHg (Cal.) |
| Flash point | 114.145°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Ethyl 2-Dimethoxyphosphorylsulfanylacetate |