Online Database of Chemicals from Around the World
|
CAS#: 208844-07-9 Product: 4-(4-Ethylcyclohexyl)-2,6-Difluoro-Benzonitrile No suppilers available for the product. |
| Name | 4-(4-Ethylcyclohexyl)-2,6-Difluoro-Benzonitrile |
|---|---|
| Synonyms | 2,6-Difluoro-4-(trans-4-ethylcyclohexyl)-benzonitrile; trans-4-(4-Ethyl-cyclohexyl)-2,6-difluoro-benzonitrile |
| Molecular Structure |  |
| Molecular Formula | C15H17F2N |
| Molecular Weight | 249.30 |
| CAS Registry Number | 208844-07-9 |
| SMILES | CC[C@H]1CC[C@@H](CC1)c2cc(c(c(c2)F)C#N)F |
| InChI | 1S/C15H17F2N/c1-2-10-3-5-11(6-4-10)12-7-14(16)13(9-18)15(17)8-12/h7-8,10-11H,2-6H2,1H3/t10-,11- |
| InChIKey | AHMVWTCTRTWLHL-XYPYZODXSA-N |
| Density | 1.118g/cm3 (Cal.) |
|---|---|
| Boiling point | 318.145°C at 760 mmHg (Cal.) |
| Flash point | 146.209°C (Cal.) |
| Refractive index | 1.508 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-(4-Ethylcyclohexyl)-2,6-Difluoro-Benzonitrile |