Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | 2-(Fluoromethyl)-6-Nitro-1,3-Benzothiazole |
|---|---|
| Synonyms | 2-(fluoromethyl)-6-nitrobenzo[d]thiazole; ZINC03202832 |
| Molecular Structure |  |
| Molecular Formula | C8H5FN2O2S |
| Molecular Weight | 212.20 |
| CAS Registry Number | 20897-48-7 |
| SMILES | [O-][N+](=O)c1ccc2nc(sc2c1)CF |
| InChI | 1S/C8H5FN2O2S/c9-4-8-10-6-2-1-5(11(12)13)3-7(6)14-8/h1-3H,4H2 |
| InChIKey | OCZQWVHLSKZAMU-UHFFFAOYSA-N |
| Density | 1.517g/cm3 (Cal.) |
|---|---|
| Boiling point | 345.374°C at 760 mmHg (Cal.) |
| Flash point | 162.677°C (Cal.) |
| Refractive index | 1.669 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-(Fluoromethyl)-6-Nitro-1,3-Benzothiazole |