Online Database of Chemicals from Around the World
|
CAS#: 20912-69-0 Product: 1-Chloro-4-(4-Methoxyphenyl)Sulfanyl-Benzene No suppilers available for the product. |
| Name | 1-Chloro-4-(4-Methoxyphenyl)Sulfanyl-Benzene |
|---|---|
| Synonyms | 1-(4-Chlorophenyl)Sulfanyl-4-Methoxy-Benzene; 1-[(4-Chlorophenyl)Thio]-4-Methoxybenzene; 1-[(4-Chlorophenyl)Thio]-4-Methoxy-Benzene |
| Molecular Structure |  |
| Molecular Formula | C13H11ClOS |
| Molecular Weight | 250.74 |
| CAS Registry Number | 20912-69-0 |
| SMILES | C2=C(SC1=CC=C(Cl)C=C1)C=CC(=C2)OC |
| InChI | 1S/C13H11ClOS/c1-15-11-4-8-13(9-5-11)16-12-6-2-10(14)3-7-12/h2-9H,1H3 |
| InChIKey | CRZNSNXESWNOEA-UHFFFAOYSA-N |
| Density | 1.267g/cm3 (Cal.) |
|---|---|
| Boiling point | 390.598°C at 760 mmHg (Cal.) |
| Flash point | 190.027°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-Chloro-4-(4-Methoxyphenyl)Sulfanyl-Benzene |