|
CAS#: 20949-28-4 Product: Ethyl 2-(1H-Indol-2-Yl)-2-Methylpropanoate No suppilers available for the product. |
| Name | Ethyl 2-(1H-Indol-2-Yl)-2-Methylpropanoate |
|---|---|
| Synonyms | 1H-Indole-2-acetic acid, α,α-dimethyl-, ethyl ester; 2-(1H-Indol-2-yl)-2-méthylpropanoate d'éthyle; Ethyl 2-(1H-indol-2-yl)-2-methylpropanoate |
| Molecular Structure | ![]() |
| Molecular Formula | C14H17NO2 |
| Molecular Weight | 231.29 |
| CAS Registry Number | 20949-28-4 |
| SMILES | CCOC(=O)C(C)(C)c1cc2ccccc2[nH]1 |
| InChI | 1S/C14H17NO2/c1-4-17-13(16)14(2,3)12-9-10-7-5-6-8-11(10)15-12/h5-9,15H,4H2,1-3H3 |
| InChIKey | RLZKIOZEXCKNCF-UHFFFAOYSA-N |
| Density | 1.1±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 363.9±17.0°C at 760 mmHg (Cal.) |
| Flash point | 173.9±20.9°C (Cal.) |
| Refractive index | 1.577 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Ethyl 2-(1H-Indol-2-Yl)-2-Methylpropanoate |