Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Name | 1,2-Benzenedicarboximidamide |
|---|---|
| Synonyms | 1,2-DIAMIDINOBENZENE; Benzenediamidine |
| Molecular Structure |  |
| Molecular Formula | C8H10N4 |
| Molecular Weight | 162.19 |
| CAS Registry Number | 210051-59-5 |
| SMILES | C1=CC=C(C(=C1)C(=N)N)C(=N)N |
| InChI | 1S/C8H10N4/c9-7(10)5-3-1-2-4-6(5)8(11)12/h1-4H,(H3,9,10)(H3,11,12) |
| InChIKey | CZMCQHMXUGVADN-UHFFFAOYSA-N |
| Density | 1.4±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 321.1±52.0°C at 760 mmHg (Cal.) |
| Flash point | 148.0±30.7°C (Cal.) |
| Refractive index | 1.665 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,2-Benzenedicarboximidamide |