| Beijing Eagle Sky Pharmatech Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
![]() | www.eagleskypharmatech.com | |||
![]() | +86 (10) 5979-9429 8875-5821 | |||
![]() | +86 (10) 5804-3698 | |||
![]() | sophia_818@126.com contact@eagleskypharmatech.com | |||
![]() | QQ Chat | |||
| Chemical manufacturer since 2009 | ||||
| chemBlink Standard supplier since 2010 | ||||
| Neostar United (Changzhou) Industrial Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
![]() | www.neostarunited.com | |||
![]() | +86 (519) 8555-7386 +86 18015025600 | |||
![]() | +86 (519) 8555-7389 | |||
![]() | marketing1@neostarunited.com | |||
| Chemical distributor since 2014 | ||||
| chemBlink Standard supplier since 2020 | ||||
| Classification | Organic raw materials >> Heterocyclic compound >> Piperidines |
|---|---|
| Name | N-Acetyl-L-phenylalanine compd. with 2-[(S)-(4-chlorophenyl)(4-piperidinyloxy)methyl]pyridine (1:1) |
| Synonyms | (S)-2-((4-Chlorophenyl)(piperidin-4-yloxy)methyl)pyridine (S)-2-acetamido-3-phenylpropanoate |
| Molecular Structure | ![]() |
| Molecular Formula | C17H19ClN2O.C11H13NO3 |
| Molecular Weight | 510.02 |
| CAS Registry Number | 210095-66-2 |
| SMILES | CC(=O)NC(CC1=CC=CC=C1)C(=O)O.C1CNCCC1OC(C2=CC=C(C=C2)Cl)C3=CC=CC=N3 |
| Hazard Symbols | |
|---|---|
| Risk Statements | H302-H315-H319-H335 Details |
| Safety Statements | P261-P264-P270-P271-P280-P302-P304-P321-P330-P340-P352-P362-P364-P405 Details |
| SDS | Available |
|
N-Acetyl-L-phenylalanine compd. with 2-[(S)-(4-chlorophenyl)(4-piperidinyloxy)methyl]pyridine (1:1) is a chemical compound of interest in medicinal chemistry, combining an amino acid derivative, N-acetyl-L-phenylalanine, with a pyridine-based molecule that contains a piperidinyloxy and a chlorophenyl group. This combination results in a compound with potentially unique bioactive properties due to the synergistic effects of the two constituent components. The discovery of N-acetyl-L-phenylalanine compd. with 2-[(S)-(4-chlorophenyl)(4-piperidinyloxy)methyl]pyridine stems from ongoing research into the development of novel therapeutics targeting various biological systems. N-acetyl-L-phenylalanine, a derivative of the essential amino acid L-phenylalanine, has been studied for its involvement in various biochemical processes, particularly in neurotransmitter synthesis and protein metabolism. When combined with the pyridine derivative containing the piperidinyloxy group, the resulting compound may exhibit enhanced pharmacological activity, particularly with respect to interactions with receptors and enzymes in the central nervous system (CNS). The presence of the piperidinyloxy group in the structure of 2-[(S)-(4-chlorophenyl)(4-piperidinyloxy)methyl]pyridine suggests potential interaction with neurotransmitter systems, including those related to dopamine, serotonin, and norepinephrine. These neurotransmitters play critical roles in mood regulation, cognition, and motor function. As such, the compound holds promise in the treatment of neurological conditions such as depression, schizophrenia, or Parkinson’s disease. Additionally, the chlorophenyl group in the structure could contribute to the compound's ability to cross the blood-brain barrier, enhancing its potential efficacy as a CNS-active drug. The combination of N-acetyl-L-phenylalanine with 2-[(S)-(4-chlorophenyl)(4-piperidinyloxy)methyl]pyridine results in a molecule that may exhibit both pharmacological and synthetic utility. The N-acetyl-L-phenylalanine portion of the compound serves as a stabilizing group, enhancing the solubility and bioavailability of the molecule. This structural feature may also contribute to its selective binding to certain receptors, enhancing its therapeutic potential. In chemical synthesis, this compound could be valuable as a building block for the development of more complex molecules with specific pharmacological properties. Its unique combination of amino acid and pyridine-based motifs presents an opportunity for the creation of targeted drug candidates with increased potency and selectivity. Additionally, the chiral nature of the molecule could result in enantiomeric forms with differing bioactivity, opening the door for more refined therapeutic options. Another application of N-acetyl-L-phenylalanine compd. with 2-[(S)-(4-chlorophenyl)(4-piperidinyloxy)methyl]pyridine is in the field of enzyme inhibition. The presence of the piperidinyloxy group may facilitate interaction with enzymes involved in neurotransmitter metabolism or signaling, potentially leading to the modulation of enzyme activity. This could have applications in the treatment of disorders involving enzyme dysfunction, such as certain metabolic or neurodegenerative diseases. In conclusion, N-acetyl-L-phenylalanine compd. with 2-[(S)-(4-chlorophenyl)(4-piperidinyloxy)methyl]pyridine (1:1) is a compound with potential applications in drug development, particularly for CNS-related disorders. The unique combination of an amino acid derivative with a pyridine-based, piperidine-containing structure offers opportunities for enhanced pharmacological activity, making it a promising candidate for further research and development. References none |
| Market Analysis Reports |
| List of Reports Available for N-Acetyl-L-phenylalanine compd. with 2-[(S)-(4-chlorophenyl)(4-piperidinyloxy)methyl]pyridine (1:1) |