|
CAS#: 2103-46-0 Product: N'-(4-Chlorophenyl)-N,N-Dimethylmethanimidamide No suppilers available for the product. |
| Name | N'-(4-Chlorophenyl)-N,N-Dimethylmethanimidamide |
|---|---|
| Synonyms | N'-(4-Chlorophenyl)-N,N-Dimethyl-Formamidine; N'-(4-Chlorophenyl)-N,N-Dimethylformamidine; N'-(4-Chlorophenyl)-N,N-Dimethyl-Methanimidamide |
| Molecular Structure | ![]() |
| Molecular Formula | C9H11ClN2 |
| Molecular Weight | 182.65 |
| CAS Registry Number | 2103-46-0 |
| SMILES | C1=C(N=CN(C)C)C=CC(=C1)Cl |
| InChI | 1S/C9H11ClN2/c1-12(2)7-11-9-5-3-8(10)4-6-9/h3-7H,1-2H3 |
| InChIKey | ZPTXBCJETBDOAT-UHFFFAOYSA-N |
| Density | 1.062g/cm3 (Cal.) |
|---|---|
| Boiling point | 261.25°C at 760 mmHg (Cal.) |
| Flash point | 111.801°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N'-(4-Chlorophenyl)-N,N-Dimethylmethanimidamide |