Online Database of Chemicals from Around the World
| Achemica | Switzerland | Inquire | ||
|---|---|---|---|---|
 |
+41 (24) 466-2929 | |||
 |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
|
+1 (201) 478-8534 | |||
|
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Name | Dimethyl(Triphenylstannyl)Vinylsilane |
|---|---|
| Synonyms | Triphenyl stannyl dimethyl vinyl silane; Triphenylstannyldimethylvinylsilane |
| Molecular Structure |  |
| Molecular Formula | C22H24SiSn |
| Molecular Weight | 435.22 |
| CAS Registry Number | 210362-73-5 |
| SMILES | C[Si](C)(C=C)[Sn](c1ccccc1)(c2ccccc2)c3ccccc3 |
| InChI | 1S/3C6H5.C4H9Si.Sn/c3*1-2-4-6-5-3-1;1-4-5(2)3;/h3*1-5H;4H,1H2,2-3H3; |
| InChIKey | OSDDJKHOWAJPID-UHFFFAOYSA-N |
| Melting point | 210°C (Expl.) |
|---|---|
| Boiling point | 416.924°C at 760 mmHg (Cal.) |
| Flash point | 205.948°C (Cal.) |
| Refractive index | (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Dimethyl(Triphenylstannyl)Vinylsilane |