Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Santa Cruz Biotechnology, Inc. | USA | Inquire | ||
|---|---|---|---|---|
|
+1 (831) 457-3800 | |||
|
scbt@scbt.com | |||
| Chemical manufacturer | ||||
| Name | 4-[4-(Diphenylmethoxy)-1-Piperidinyl]-1-[4-(1-Hydroxy-2-Methyl-2-Propanyl)Phenyl]-1-Butanone |
|---|---|
| Synonyms | Hydroxy Ebastine |
| Molecular Structure | ![CAS#: 210686-41-2， 4-[4-(Diphenylmethoxy)-1-Piperidinyl]-1-[4-(1-Hydroxy-2-Methyl-2-Propanyl)Phenyl]-1-Butanone](/moreStructures/210686-41-2.gif) |
| Molecular Formula | C32H39NO3 |
| Molecular Weight | 485.66 |
| CAS Registry Number | 210686-41-2 |
| SMILES | O=C(c1ccc(cc1)C(C)(C)CO)CCCN4CCC(OC(c2ccccc2)c3ccccc3)CC4 |
| InChI | 1S/C32H39NO3/c1-32(2,24-34)28-17-15-25(16-18-28)30(35)14-9-21-33-22-19-29(20-23-33)36-31(26-10-5-3-6-11-26)27-12-7-4-8-13-27/h3-8,10-13,15-18,29,31,34H,9,14,19-24H2,1-2H3 |
| InChIKey | UDZUMQUGNZBRMN-UHFFFAOYSA-N |
| Density | 1.14g/cm3 (Cal.) |
|---|---|
| Boiling point | 632.8°C at 760 mmHg (Cal.) |
| Flash point | 336.5°C (Cal.) |
| Refractive index | 1.602 (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 4-[4-(Diphenylmethoxy)-1-Piperidinyl]-1-[4-(1-Hydroxy-2-Methyl-2-Propanyl)Phenyl]-1-Butanone |