Online Database of Chemicals from Around the World
|
CAS#: 21080-31-9 Product: Angoline No suppilers available for the product. |
| Name | Angoline |
|---|---|
| Synonyms | Angoline; C09336 |
| Molecular Structure |  |
| Molecular Formula | C22H21NO5 |
| Molecular Weight | 379.41 |
| CAS Registry Number | 21080-31-9 |
| SMILES | C2=C5C(=CC3=CC=C1C4=C(C(N(C1=C23)C)OC)C(=C(C=C4)OC)OC)OCO5 |
| InChI | 1S/C22H21NO5/c1-23-20-14(6-5-12-9-17-18(10-15(12)20)28-11-27-17)13-7-8-16(24-2)21(25-3)19(13)22(23)26-4/h5-10,22H,11H2,1-4H3 |
| InChIKey | LVWAKZBZWYHYCJ-UHFFFAOYSA-N |
| Density | 1.36g/cm3 (Cal.) |
|---|---|
| Boiling point | 555.493°C at 760 mmHg (Cal.) |
| Flash point | 164.11°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Angoline |