|
CAS#: 21133-81-3 Product: 2-(4-Bromophenyl)-4-Methyl-2,4-Pentanediol No suppilers available for the product. |
| Name | 2-(4-Bromophenyl)-4-Methyl-2,4-Pentanediol |
|---|---|
| Synonyms | 2-(4-Bromophenyl)-4-Methyl-Pentane-2,4-Diol; 2,4-Pentanediol, 2-(P-Bromophenyl)-4-Methyl-; Brn 2108770 |
| Molecular Structure | ![]() |
| Molecular Formula | C12H17BrO2 |
| Molecular Weight | 273.17 |
| CAS Registry Number | 21133-81-3 |
| SMILES | C1=C(C(O)(CC(O)(C)C)C)C=CC(=C1)Br |
| InChI | 1S/C12H17BrO2/c1-11(2,14)8-12(3,15)9-4-6-10(13)7-5-9/h4-7,14-15H,8H2,1-3H3 |
| InChIKey | VVNFRLVEGCQIMB-UHFFFAOYSA-N |
| Density | 1.363g/cm3 (Cal.) |
|---|---|
| Boiling point | 381.932°C at 760 mmHg (Cal.) |
| Flash point | 184.786°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-(4-Bromophenyl)-4-Methyl-2,4-Pentanediol |