Online Database of Chemicals from Around the World
|
CAS#: 211679-03-7 Product: 3-(2,3-Difluorobenzyl)Isonicotinic Acid No suppilers available for the product. |
| Name | 3-(2,3-Difluorobenzyl)Isonicotinic Acid |
|---|---|
| Synonyms | 3-((2,3-Difluorophenyl)methyl)-4-pyridinecarboxylicacid |
| Molecular Structure |  |
| Molecular Formula | C13H9F2NO2 |
| Molecular Weight | 249.21 |
| CAS Registry Number | 211679-03-7 |
| SMILES | c1cc(c(c(c1)F)F)Cc2cnccc2C(=O)O |
| InChI | 1S/C13H9F2NO2/c14-11-3-1-2-8(12(11)15)6-9-7-16-5-4-10(9)13(17)18/h1-5,7H,6H2,(H,17,18) |
| InChIKey | DOTXILIPZXGHOS-UHFFFAOYSA-N |
| Density | 1.362g/cm3 (Cal.) |
|---|---|
| Boiling point | 450.41°C at 760 mmHg (Cal.) |
| Flash point | 226.2°C (Cal.) |
| Refractive index | 1.576 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-(2,3-Difluorobenzyl)Isonicotinic Acid |