| Glentham Life Sciences | UK | Inquire | ||
|---|---|---|---|---|
![]() |
+44 (2033) 978-798 | |||
![]() |
info@glenthamls.com | |||
| Chemical distributor since 2013 | ||||
| Name | (-)-Indolmycin |
|---|---|
| Synonyms | (5S)-5-[(1R)-1-(1H-Indol-3-Yl)Ethyl]-2-Methylamino-Oxazol-4-One; (5S)-5-[(1R)-1-(1H-Indol-3-Yl)Ethyl]-2-Methylamino-4-Oxazolone; (1R,5S)-(-)-5-(1-Indol-3-Ylethyl)-2-(Methylamino)-2-Oxazolin-4-One |
| Molecular Structure | ![]() |
| Molecular Formula | C14H15N3O2 |
| Molecular Weight | 257.29 |
| CAS Registry Number | 21200-24-8 |
| SMILES | [C@@H](C1=C[NH]C2=C1C=CC=C2)([C@@H]3OC(=NC3=O)NC)C |
| InChI | 1S/C14H15N3O2/c1-8(12-13(18)17-14(15-2)19-12)10-7-16-11-6-4-3-5-9(10)11/h3-8,12,16H,1-2H3,(H,15,17,18)/t8-,12+/m1/s1 |
| InChIKey | GNTVWGDQPXCYBV-PELKAZGASA-N |
| Density | 1.4±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 420.8±37.0°C at 760 mmHg (Cal.) |
| Flash point | 208.3±26.5°C (Cal.) |
| SDS | Available |
|---|---|
| (1) | David O'Hagan and Jason W. Schmidberger. Enzymes that catalyse S2 reaction mechanisms, Nat. Prod. Rep., 2010, 27, 900. |
|---|---|
| Market Analysis Reports |
| List of Reports Available for (-)-Indolmycin |