Online Database of Chemicals from Around the World
| Name | 3-(Methoxycarbonyl)Benzophenone |
|---|---|
| Synonyms | 3-(Oxo-Phenylmethyl)Benzoic Acid Methyl Ester; 3-(Benzoyl)Benzoic Acid Methyl Ester; Methyl 3-Phenylcarbonylbenzoate |
| Molecular Structure |  |
| Molecular Formula | C15H12O3 |
| Molecular Weight | 240.26 |
| CAS Registry Number | 21204-86-4 |
| SMILES | C1=CC=C(C=C1C(OC)=O)C(=O)C2=CC=CC=C2 |
| InChI | 1S/C15H12O3/c1-18-15(17)13-9-5-8-12(10-13)14(16)11-6-3-2-4-7-11/h2-10H,1H3 |
| InChIKey | FOBUHGGUSGQWRJ-UHFFFAOYSA-N |
| Density | 1.169g/cm3 (Cal.) |
|---|---|
| Boiling point | 385.614°C at 760 mmHg (Cal.) |
| Flash point | 171.637°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-(Methoxycarbonyl)Benzophenone |
