Online Database of Chemicals from Around the World
|
CAS#: 2122-29-4 Product: Retamine No suppilers available for the product. |
| Name | Retamine |
|---|---|
| Synonyms | Retamine |
| Molecular Structure |  |
| Molecular Formula | C15H26N2O |
| Molecular Weight | 250.38 |
| CAS Registry Number | 2122-29-4 |
| SMILES | [C@H]13[C@@H]4N(C[C@@H]([C@H]2N(C1)CCCC2)C3)CCC[C@@H]4O |
| InChI | 1S/C15H26N2O/c18-14-5-3-7-17-9-11-8-12(15(14)17)10-16-6-2-1-4-13(11)16/h11-15,18H,1-10H2/t11-,12+,13-,14-,15-/m0/s1 |
| InChIKey | JMXNBIDTNISOTA-AICCOOGYSA-N |
| Density | 1.168g/cm3 (Cal.) |
|---|---|
| Boiling point | 375.902°C at 760 mmHg (Cal.) |
| Flash point | 179.094°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Retamine |